Products 1894317-53-3
CAS 1894317-53-3 appears in our catalog under these names: 1-(2-Trifluoromethyl-benzyl)-1h-pyrazol-4-ol, 95%, 1-{(2-(Trifluoromethyl)phenyl)methyl}-1H-pyrazol-4-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-ol (CAS 1894317-53-3) is a chemical compound with the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. IUPAC name: 1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-ol. InChIKey: AFKXMELXFVZADA-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 1-[[2-(trifluoromethyl)phenyl]methyl]pyrazol-4-ol |
| InChIKey | AFKXMELXFVZADA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(C=N2)O)C(F)(F)F |
Computed by PubChem (NCBI)