CAS 2228513-14-0 is the registry number for 1-(4-(1H-Pyrazol-1-yl)phenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(4-pyrazol-1-ylphenyl)ethanol (CAS 2228513-14-0) is a chemical compound with the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-pyrazol-1-ylphenyl)ethanol. InChIKey: CMWOVCGHHAXMLQ-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N2O |
|---|---|
| Molecular weight | 242.20 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-pyrazol-1-ylphenyl)ethanol |
| InChIKey | CMWOVCGHHAXMLQ-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)C2=CC=C(C=C2)C(C(F)(F)F)O |
Computed by PubChem (NCBI)