CAS 1113001-78-7 appears in our catalog under these names: Bicyclo[1.1.1]pentane-1-acetic acid, 3-(hydroxy-methyl)-, 1,1-dimethylethyl ester, 95%, tert-Butyl 2-(3-(hydroxymethyl)bicyclo(1.1.1)pentan-1-yl)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 250mg, 1g.
Tert-butyl 2-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetate (CAS 1113001-78-7) is a chemical compound with the molecular formula C12H20O3 and a molecular weight of 212.28 g/mol. IUPAC name: tert-butyl 2-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetate. InChIKey: XLCPGBUFZLHWOH-UHFFFAOYSA-N.
| Molecular formula | C12H20O3 |
|---|---|
| Molecular weight | 212.28 g/mol |
| IUPAC name | tert-butyl 2-[3-(hydroxymethyl)-1-bicyclo[1.1.1]pentanyl]acetate |
| InChIKey | XLCPGBUFZLHWOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC12CC(C1)(C2)CO |
Computed by PubChem (NCBI)