Products 42895-97-6
CAS 42895-97-6 is the registry number for Ethyl (E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate (CAS 42895-97-6) is a chemical compound with the molecular formula C12H20O3 and a molecular weight of 212.28 g/mol. IUPAC name: ethyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate. InChIKey: SUZRSVLRBYXDFA-CSKARUKUSA-N.
| Molecular formula | C12H20O3 |
|---|---|
| Molecular weight | 212.28 g/mol |
| IUPAC name | ethyl (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
| InChIKey | SUZRSVLRBYXDFA-CSKARUKUSA-N |
| SMILES | CCOC(=O)/C(=C/CCC(C)(C=C)O)/C |
Computed by PubChem (NCBI)