Products 26315-61-7
CAS 26315-61-7 appears in our catalog under these names: (1R)-(-)-Menthyl glyoxylate hydrate, 98%, (1R)–(–)–Menthyl glyoxylate hydrate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 5g, 100g, 1g, 200mg.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-oxoacetate (CAS 26315-61-7) is a chemical compound with the molecular formula C12H20O3 and a molecular weight of 212.28 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-oxoacetate. InChIKey: YNUVAJRGRQBLLB-OUAUKWLOSA-N.
| Molecular formula | C12H20O3 |
|---|---|
| Molecular weight | 212.28 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-oxoacetate |
| InChIKey | YNUVAJRGRQBLLB-OUAUKWLOSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)C=O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
(1R,2S,5R)-2-isopropyl-5-methylcyclohexyl 2-oxoacetate, (-)-menthyl glyoxylate, L-menthyl glyoxylate, (1R,2S,5R)-5-methyl-2-(propan-2-yl)cyclohexyl 2-oxoacetate, Acetic acid, 2-oxo-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, L-menthylglyoxylate, (1R,2S,5R)-5-Methyl-2-(propan-2-yl)cyclohexyl oxoacetate