CAS 111399-60-1 appears in our catalog under these names: 3-Methyl-d3-indole, >95% (HPLC), 3-Methyl-d3-indole, 99 atom % D, min 98% Chemical Purity, Skatole–d3, Skatole-d3, 99.10%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 250mg, 25mg, 0,05g, 0,01g, 10mg, 5mg, 10 mg, 5 mg.
3-(trideuteriomethyl)-1H-indole (CAS 111399-60-1) is a chemical compound with the molecular formula C9H9N and a molecular weight of 134.19 g/mol. IUPAC name: 3-(trideuteriomethyl)-1H-indole. InChIKey: ZFRKQXVRDFCRJG-FIBGUPNXSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 134.19 g/mol |
| IUPAC name | 3-(trideuteriomethyl)-1H-indole |
| InChIKey | ZFRKQXVRDFCRJG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)