Products 697807-03-7
CAS 697807-03-7 appears in our catalog under these names: 3-Methyl-1H-Indole-d8, >95% (HPLC), 3-Methylindole-d8,NH, 99 atom % D, min 98% Chemical Purity, Skatole–d8, Skatole-d8, 98.50%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,01g, 1mg, 1 mg, 5 mg.
2,4,5,6,7-pentadeuterio-3-(trideuteriomethyl)-1H-indole (CAS 697807-03-7) is a chemical compound with the molecular formula C9H9N and a molecular weight of 139.22 g/mol. IUPAC name: 2,4,5,6,7-pentadeuterio-3-(trideuteriomethyl)-1H-indole. InChIKey: ZFRKQXVRDFCRJG-JGUCLWPXSA-N.
| Molecular formula | C9H9N |
|---|---|
| Molecular weight | 139.22 g/mol |
| IUPAC name | 2,4,5,6,7-pentadeuterio-3-(trideuteriomethyl)-1H-indole |
| InChIKey | ZFRKQXVRDFCRJG-JGUCLWPXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C([2H])([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)