CAS 1116-95-6 is the registry number for Carnitine Chloride Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride (CAS 1116-95-6) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: [(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: ZOYKKWXSDFNANU-FJXQXJEOSA-M.
| Molecular formula | C7H15ClN2O |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | [(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | ZOYKKWXSDFNANU-FJXQXJEOSA-M |
| SMILES | C[N+](C)(C)C[C@H](CC#N)O.[Cl-] |
Computed by PubChem (NCBI)