Products 1116-95-6

CAS 1116-95-6 is the registry number for Carnitine Chloride Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride (CAS 1116-95-6) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: [(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: ZOYKKWXSDFNANU-FJXQXJEOSA-M.

Identity
Molecular formulaC7H15ClN2O
Molecular weight178.66 g/mol
IUPAC name[(2S)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride
InChIKeyZOYKKWXSDFNANU-FJXQXJEOSA-M
SMILESC[N+](C)(C)C[C@H](CC#N)O.[Cl-]

Computed by PubChem (NCBI)