CAS 2788-28-5 appears in our catalog under these names: (R)-3-Cyano-2-hydroxy-n,n,n-trimethyl-1-propanaminium chloride, 95%, L-Carnitinenitrile Chloride, Levocarnitine Impurity 14, (2R)–Carnitinenitrile Chloride, (R)-3-Cyano-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, on request, 100g, 25g, 1kg.
[(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride (CAS 2788-28-5) is a chemical compound with the molecular formula C7H15ClN2O and a molecular weight of 178.66 g/mol. IUPAC name: [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: ZOYKKWXSDFNANU-OGFXRTJISA-M.
| Molecular formula | C7H15ClN2O |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | [(2R)-3-cyano-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | ZOYKKWXSDFNANU-OGFXRTJISA-M |
| SMILES | C[N+](C)(C)C[C@@H](CC#N)O.[Cl-] |
Computed by PubChem (NCBI)