CAS 1116681-96-9 appears in our catalog under these names: 4,5-Dichloro-2-fluorophenylboronic acid, pinacol ester, 96%, 4,5-Dichloro-2-fluorophenylboronic acid, pinacol ester, 95-<97%, 2-(4,5-Dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 4,5-Dichloro-2-fluorophenylboronic acid pinacol ester, 98%, 98%, 2-(4,5-Dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 10g, 25g, 50g, 100mg.
2-(4,5-dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1116681-96-9) is a chemical compound with the molecular formula C12H14BCl2FO2 and a molecular weight of 291.0 g/mol. IUPAC name: 2-(4,5-dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PMLQYOJKCHQKNC-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl2FO2 |
|---|---|
| Molecular weight | 291.0 g/mol |
| IUPAC name | 2-(4,5-dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PMLQYOJKCHQKNC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)Cl)Cl |
Computed by PubChem (NCBI)