CAS 2121515-08-8 appears in our catalog under these names: 3,5-Dichloro-2-fluorophenylboronic acid pinacol ester, 95%, 2-(3,5-Dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 3,5-Dichloro-2-fluorophenylboronic acid pinacol ester, ≥95%, ≥95%, 3,5-Dichloro-2-fluorophenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
2-(3,5-dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121515-08-8) is a chemical compound with the molecular formula C12H14BCl2FO2 and a molecular weight of 291.0 g/mol. IUPAC name: 2-(3,5-dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MCVABORQBRLBOY-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl2FO2 |
|---|---|
| Molecular weight | 291.0 g/mol |
| IUPAC name | 2-(3,5-dichloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MCVABORQBRLBOY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)Cl)Cl |
Computed by PubChem (NCBI)