Products 1437779-89-9
CAS 1437779-89-9 is the registry number for 2-(3,4-Dichloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3,4-dichloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1437779-89-9) is a chemical compound with the molecular formula C12H14BCl2FO2 and a molecular weight of 291.0 g/mol. IUPAC name: 2-(3,4-dichloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SSILPVWFHDZJQO-UHFFFAOYSA-N.
| Molecular formula | C12H14BCl2FO2 |
|---|---|
| Molecular weight | 291.0 g/mol |
| IUPAC name | 2-(3,4-dichloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SSILPVWFHDZJQO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)Cl)Cl)F |
Computed by PubChem (NCBI)