CAS 1116681-99-2 appears in our catalog under these names: 2,3-Difluoro-4-methylphenylboronic acid pinacol ester, 98%, 2,3-Difluoro-4-methylphenylboronic acid pinacol ester, 97%, 97%, 2-(2,3-Difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
2-(2,3-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1116681-99-2) is a chemical compound with the molecular formula C13H17BF2O2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(2,3-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NFVNNZSSZYGQKF-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(2,3-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NFVNNZSSZYGQKF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)C)F)F |
Computed by PubChem (NCBI)