CAS 2094504-03-5 appears in our catalog under these names: 3,5-Difluoro-4-methylphenylboronic acid pinacol ester, 95%, 2-(3,5-Difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 3,5-Difluoro-4-methylphenylboronic acid pinacol ester, ≥95%, ≥95%, 3,5-Difluoro-4-methylphenylboronic acid pinacol ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(3,5-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2094504-03-5) is a chemical compound with the molecular formula C13H17BF2O2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(3,5-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WEFLGURYLOQWJC-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(3,5-difluoro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WEFLGURYLOQWJC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)C)F |
Computed by PubChem (NCBI)