Products 1025707-98-5
CAS 1025707-98-5 is the registry number for 2,5-Difluoro-6-methylbenzeneboronic acid, pinacol ester, 97%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(3,6-difluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1025707-98-5) is a chemical compound with the molecular formula C13H17BF2O2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-(3,6-difluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: UDPBNEWJKRXZKS-UHFFFAOYSA-N.
| Molecular formula | C13H17BF2O2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-(3,6-difluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | UDPBNEWJKRXZKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2C)F)F |
Computed by PubChem (NCBI)