CAS 1117-41-5 appears in our catalog under these names: Methylisopseudoionone, 3,5,9-Undecatrien-2-one,3,6,10-trimethyl-, 90%, 90%. Offered by: TRC, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 5mg, 25mg.
(3E,5E)-3,6,10-trimethylundeca-3,5,9-trien-2-one (CAS 1117-41-5) is a chemical compound with the molecular formula C14H22O and a molecular weight of 206.32 g/mol. IUPAC name: (3E,5E)-3,6,10-trimethylundeca-3,5,9-trien-2-one. InChIKey: PRMAVUPVLGOONQ-JOWSBRCASA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 206.32 g/mol |
| IUPAC name | (3E,5E)-3,6,10-trimethylundeca-3,5,9-trien-2-one |
| InChIKey | PRMAVUPVLGOONQ-JOWSBRCASA-N |
| SMILES | CC(=CCC/C(=C/C=C(\C)/C(=O)C)/C)C |
Computed by PubChem (NCBI)