CAS 1118114-88-7 is the registry number for (S)-1-(1H-Benzo[d]imidazol-2-yl)-2,2-dimethylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1H-benzimidazol-2-yl)-2,2-dimethylpropan-1-amine (CAS 1118114-88-7) is a chemical compound with the molecular formula C12H17N3 and a molecular weight of 203.28 g/mol. IUPAC name: 1-(1H-benzimidazol-2-yl)-2,2-dimethylpropan-1-amine. InChIKey: GYFNABLHDUXEKF-UHFFFAOYSA-N.
| Molecular formula | C12H17N3 |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 1-(1H-benzimidazol-2-yl)-2,2-dimethylpropan-1-amine |
| InChIKey | GYFNABLHDUXEKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=NC2=CC=CC=C2N1)N |
Computed by PubChem (NCBI)