CAS 338423-02-2 is the registry number for 5,6-Dimethyl-1-(propan-2-yl)-1h-1,3-benzodiazol-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5,6-dimethyl-1-propan-2-ylbenzimidazol-4-amine (CAS 338423-02-2) is a chemical compound with the molecular formula C12H17N3 and a molecular weight of 203.28 g/mol. IUPAC name: 5,6-dimethyl-1-propan-2-ylbenzimidazol-4-amine. InChIKey: JSDJDEZOUUPUON-UHFFFAOYSA-N.
| Molecular formula | C12H17N3 |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 5,6-dimethyl-1-propan-2-ylbenzimidazol-4-amine |
| InChIKey | JSDJDEZOUUPUON-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1C)N)N=CN2C(C)C |
Computed by PubChem (NCBI)