CAS 933719-67-6 appears in our catalog under these names: 3-(6,7-Dimethyl-1h-benzimidazol-2-yl)propan-1-amine hydrochloride, 95%, [3-(4,5-dimethyl-1H-benzimidazol-2-yl)propyl]amine dihydrochloride hydrate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
3-(4,5-dimethyl-1H-benzimidazol-2-yl)propan-1-amine (CAS 933719-67-6) is a chemical compound with the molecular formula C12H17N3 and a molecular weight of 203.28 g/mol. IUPAC name: 3-(4,5-dimethyl-1H-benzimidazol-2-yl)propan-1-amine. InChIKey: JAYAETBUIDWSOJ-UHFFFAOYSA-N.
| Molecular formula | C12H17N3 |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | 3-(4,5-dimethyl-1H-benzimidazol-2-yl)propan-1-amine |
| InChIKey | JAYAETBUIDWSOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=N2)CCCN)C |
Computed by PubChem (NCBI)