CAS 1118786-87-0 appears in our catalog under these names: 2,2-Bis(propan-2-yl) 6,6-dimethoxyspiro[3.3]heptane-2,2-dicarboxylate, 97%, 2,2-BIs(propan-2-yl) 6,6-dimethoxyspiro(3.3)heptane-2,2-dicarboxylate, 98%, 2,2-Bis(propan-2-yl) 6,6-dimethoxyspiro(3.3)heptane-2,2-dicarboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
Dipropan-2-yl 2,2-dimethoxyspiro[3.3]heptane-6,6-dicarboxylate (CAS 1118786-87-0) is a chemical compound with the molecular formula C17H28O6 and a molecular weight of 328.4 g/mol. IUPAC name: dipropan-2-yl 2,2-dimethoxyspiro[3.3]heptane-6,6-dicarboxylate. InChIKey: ZCZRABRYWOITQF-UHFFFAOYSA-N.
| Molecular formula | C17H28O6 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | dipropan-2-yl 2,2-dimethoxyspiro[3.3]heptane-6,6-dicarboxylate |
| InChIKey | ZCZRABRYWOITQF-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1(CC2(C1)CC(C2)(OC)OC)C(=O)OC(C)C |
Computed by PubChem (NCBI)