CAS 2939750-83-9 is the registry number for rel-(1S,3R,5S)-3,5-bis(tert-butoxycarbonyl)cyclohexane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(3R,5S)-3,5-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid (CAS 2939750-83-9) is a chemical compound with the molecular formula C17H28O6 and a molecular weight of 328.4 g/mol. IUPAC name: cis-(3R,5S)-3,5-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid. InChIKey: JHWFIKJEKRSTFP-YOGCLGLASA-N.
| Molecular formula | C17H28O6 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | cis-(3R,5S)-3,5-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid |
| InChIKey | JHWFIKJEKRSTFP-YOGCLGLASA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](CC(C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)