CAS 57671-28-0 appears in our catalog under these names: Pentaethylene glycol monobenzyl ether, 95%, BnO–PEG5–OH, Pentaethylene Glycol Monobenzyl Ether, >95.0%(GC), 1-Phenyl-2,5,8,11,14-pentaoxahexadecan-16-ol, 98%, 98%, BnO-PEG5-OH, 99.26%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, 500mg, 10g, 25g, 50g, 100g.
2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol (CAS 57671-28-0) is a chemical compound with the molecular formula C17H28O6 and a molecular weight of 328.4 g/mol. IUPAC name: 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol. InChIKey: UMUSOTNGYAALST-UHFFFAOYSA-N.
| Molecular formula | C17H28O6 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | UMUSOTNGYAALST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCOCCO |
Computed by PubChem (NCBI)