CAS 1118787-11-3 appears in our catalog under these names: 6-Cyclopropyl-2-(methylsulfanyl)pyrimidine-4-carboxylic acid, 95%, 6-Cyclopropyl-2-(methylsulfanyl)pyrimidine-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
6-cyclopropyl-2-methylsulfanylpyrimidine-4-carboxylic acid (CAS 1118787-11-3) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 6-cyclopropyl-2-methylsulfanylpyrimidine-4-carboxylic acid. InChIKey: CTIULVWBXFFROZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 6-cyclopropyl-2-methylsulfanylpyrimidine-4-carboxylic acid |
| InChIKey | CTIULVWBXFFROZ-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=CC(=N1)C(=O)O)C2CC2 |
Computed by PubChem (NCBI)