CAS 1118787-28-2 appears in our catalog under these names: 2-{((2-Nitrophenyl)methyl)sulfanyl}pyrimidine, 2-{((2-nitrophenyl)methyl)sulfanyl}pyrimidine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 5g.
2-[(2-nitrophenyl)methylsulfanyl]pyrimidine (CAS 1118787-28-2) is a chemical compound with the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. IUPAC name: 2-[(2-nitrophenyl)methylsulfanyl]pyrimidine. InChIKey: MVQYJUAXCDRZSW-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2S |
|---|---|
| Molecular weight | 247.28 g/mol |
| IUPAC name | 2-[(2-nitrophenyl)methylsulfanyl]pyrimidine |
| InChIKey | MVQYJUAXCDRZSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC2=NC=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)