Products 2140317-00-4
CAS 2140317-00-4 is the registry number for Ethyl N-(6-cyano-1,3-benzothiazol-2-yl)carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl N-(6-cyano-1,3-benzothiazol-2-yl)carbamate (CAS 2140317-00-4) is a chemical compound with the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. IUPAC name: ethyl N-(6-cyano-1,3-benzothiazol-2-yl)carbamate. InChIKey: NBGPJAYQBNVWOA-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2S |
|---|---|
| Molecular weight | 247.28 g/mol |
| IUPAC name | ethyl N-(6-cyano-1,3-benzothiazol-2-yl)carbamate |
| InChIKey | NBGPJAYQBNVWOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=NC2=C(S1)C=C(C=C2)C#N |
Computed by PubChem (NCBI)