CAS 749889-22-3 is the registry number for 6-(2-Amino-1,3-thiazol-4-yl)-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(2-amino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (CAS 749889-22-3) is a chemical compound with the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. IUPAC name: 6-(2-amino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one. InChIKey: ABNPNGOJWAZAGV-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2S |
|---|---|
| Molecular weight | 247.28 g/mol |
| IUPAC name | 6-(2-amino-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| InChIKey | ABNPNGOJWAZAGV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)