Products 1119200-33-7
CAS 1119200-33-7 is the registry number for hCAIX/XII-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]-4-methylchromen-2-one (CAS 1119200-33-7) is a chemical compound with the molecular formula C20H16N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 7-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]-4-methylchromen-2-one. InChIKey: PHKWAXXKGPPHRF-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 7-[[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]-4-methylchromen-2-one |
| InChIKey | PHKWAXXKGPPHRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC3=NOC(=N3)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)
Synonyms:
hCAIX/XII-IN-4, orb1688653