Products 1119450-89-3

CAS 1119450-89-3 is the registry number for 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid (CAS 1119450-89-3) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid. InChIKey: KWQWJGVKUUSNRF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClN2O4
Molecular weight268.65 g/mol
IUPAC name3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid
InChIKeyKWQWJGVKUUSNRF-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)O)C2=NOC(=N2)CCl

Computed by PubChem (NCBI)