CAS 1119450-89-3 is the registry number for 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid (CAS 1119450-89-3) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid. InChIKey: KWQWJGVKUUSNRF-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O4 |
|---|---|
| Molecular weight | 268.65 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-4-methoxybenzoic acid |
| InChIKey | KWQWJGVKUUSNRF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)