Products 304456-83-5

CAS 304456-83-5 is the registry number for 4-(2-(3-Chlorobenzoyl)hydrazinyl)-4-oxobut-2-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-4-[2-(3-chlorobenzoyl)hydrazinyl]-4-oxobut-2-enoic acid (CAS 304456-83-5) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: (E)-4-[2-(3-chlorobenzoyl)hydrazinyl]-4-oxobut-2-enoic acid. InChIKey: UYLHFDBYICFZTD-SNAWJCMRSA-N.

Identity
Molecular formulaC11H9ClN2O4
Molecular weight268.65 g/mol
IUPAC name(E)-4-[2-(3-chlorobenzoyl)hydrazinyl]-4-oxobut-2-enoic acid
InChIKeyUYLHFDBYICFZTD-SNAWJCMRSA-N
SMILESC1=CC(=CC(=C1)Cl)C(=O)NNC(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)