CAS 2007915-70-8 is the registry number for 1-Phenyl-1h-imidazole-4,5-dicarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-phenylimidazole-4,5-dicarboxylic acid;hydrochloride (CAS 2007915-70-8) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: 1-phenylimidazole-4,5-dicarboxylic acid;hydrochloride. InChIKey: IEWWJYFPRGLUPY-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O4 |
|---|---|
| Molecular weight | 268.65 g/mol |
| IUPAC name | 1-phenylimidazole-4,5-dicarboxylic acid;hydrochloride |
| InChIKey | IEWWJYFPRGLUPY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC(=C2C(=O)O)C(=O)O.Cl |
Computed by PubChem (NCBI)