CAS 1119452-56-0 appears in our catalog under these names: 2-(5-Fluoro-1,3-benzoxazol-2-yl)ethanamine hydrochloride, 95%, 2-(5-Fluorobenzo(d)oxazol-2-yl)ethanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(5-fluoro-1,3-benzoxazol-2-yl)ethanamine (CAS 1119452-56-0) is a chemical compound with the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. IUPAC name: 2-(5-fluoro-1,3-benzoxazol-2-yl)ethanamine. InChIKey: WYFWALGOHDUGNZ-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O |
|---|---|
| Molecular weight | 180.18 g/mol |
| IUPAC name | 2-(5-fluoro-1,3-benzoxazol-2-yl)ethanamine |
| InChIKey | WYFWALGOHDUGNZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)N=C(O2)CCN |
Computed by PubChem (NCBI)