CAS 874216-80-5 is the registry number for (S)-6-Fluoro-3-methyl-3,4-dihydroquinoxalin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-6-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one (CAS 874216-80-5) is a chemical compound with the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. IUPAC name: (3S)-6-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: UDBZOEQVLJXEEQ-YFKPBYRVSA-N.
| Molecular formula | C9H9FN2O |
|---|---|
| Molecular weight | 180.18 g/mol |
| IUPAC name | (3S)-6-fluoro-3-methyl-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | UDBZOEQVLJXEEQ-YFKPBYRVSA-N |
| SMILES | C[C@H]1C(=O)NC2=C(N1)C=C(C=C2)F |
Computed by PubChem (NCBI)