CAS 1488355-90-3 is the registry number for 5-Fluoro-1,3-dimethyl-1h-benzo[d]imidazol-2(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-fluoro-1,3-dimethylbenzimidazol-2-one (CAS 1488355-90-3) is a chemical compound with the molecular formula C9H9FN2O and a molecular weight of 180.18 g/mol. IUPAC name: 5-fluoro-1,3-dimethylbenzimidazol-2-one. InChIKey: MYWAEUSAZZXTGT-UHFFFAOYSA-N.
| Molecular formula | C9H9FN2O |
|---|---|
| Molecular weight | 180.18 g/mol |
| IUPAC name | 5-fluoro-1,3-dimethylbenzimidazol-2-one |
| InChIKey | MYWAEUSAZZXTGT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)F)N(C1=O)C |
Computed by PubChem (NCBI)