CAS 1120249-21-9 appears in our catalog under these names: 6-Bromo-1-methyl-2-oxo-1,2-dihydroquinoline-4-carboxylic acid, 95%, 6-Bromo-1-methyl-2-oxo-1,2-dihydroquinoline-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-bromo-1-methyl-2-oxoquinoline-4-carboxylic acid (CAS 1120249-21-9) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: 6-bromo-1-methyl-2-oxoquinoline-4-carboxylic acid. InChIKey: LCGBRNZEIRMQMS-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 6-bromo-1-methyl-2-oxoquinoline-4-carboxylic acid |
| InChIKey | LCGBRNZEIRMQMS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C(=CC1=O)C(=O)O |
Computed by PubChem (NCBI)