CAS 112026-42-3 is the registry number for rel-(2R,3R)-3-Amino-2-methyl-4-oxoazetidine-1-sulfonic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid (CAS 112026-42-3) is a chemical compound with the molecular formula C4H8N2O4S and a molecular weight of 180.19 g/mol. IUPAC name: (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid. InChIKey: ISUIVWNWEDIHJD-HRFVKAFMSA-N.
| Molecular formula | C4H8N2O4S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid |
| InChIKey | ISUIVWNWEDIHJD-HRFVKAFMSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1S(=O)(=O)O)N |
Computed by PubChem (NCBI)