Products 1598361-14-8

CAS 1598361-14-8 is the registry number for 1-Sulfamoylazetidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-sulfamoylazetidine-3-carboxylic acid (CAS 1598361-14-8) is a chemical compound with the molecular formula C4H8N2O4S and a molecular weight of 180.19 g/mol. IUPAC name: 1-sulfamoylazetidine-3-carboxylic acid. InChIKey: PPGITWUVHJXSLS-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8N2O4S
Molecular weight180.19 g/mol
IUPAC name1-sulfamoylazetidine-3-carboxylic acid
InChIKeyPPGITWUVHJXSLS-UHFFFAOYSA-N
SMILESC1C(CN1S(=O)(=O)N)C(=O)O

Computed by PubChem (NCBI)