CAS 112101-74-3 is the registry number for Acetamide,N–((1R)–2–(3–(aminosulfonyl)–4–methoxyphenyl)–1–methylethyl)–. Offered by: GLPBio. Available pack sizes: 1g.
N-[(2R)-1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl]acetamide (CAS 112101-74-3) is a chemical compound with the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. IUPAC name: N-[(2R)-1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl]acetamide. InChIKey: KDHJIWMGQFZAOV-MRVPVSSYSA-N.
| Molecular formula | C12H18N2O4S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | N-[(2R)-1-(4-methoxy-3-sulfamoylphenyl)propan-2-yl]acetamide |
| InChIKey | KDHJIWMGQFZAOV-MRVPVSSYSA-N |
| SMILES | C[C@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)N)NC(=O)C |
Computed by PubChem (NCBI)