Products 1121586-32-0
CAS 1121586-32-0 is the registry number for 2-(tert-Butoxy)-4-fluoro-1-methoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-1-methoxy-2-[(2-methylpropan-2-yl)oxy]benzene (CAS 1121586-32-0) is a chemical compound with the molecular formula C11H15FO2 and a molecular weight of 198.23 g/mol. IUPAC name: 4-fluoro-1-methoxy-2-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: NKIKRHGIYGFQGD-UHFFFAOYSA-N.
| Molecular formula | C11H15FO2 |
|---|---|
| Molecular weight | 198.23 g/mol |
| IUPAC name | 4-fluoro-1-methoxy-2-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | NKIKRHGIYGFQGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=CC(=C1)F)OC |
Computed by PubChem (NCBI)