CAS 62087-82-5 appears in our catalog under these names: 1-Adamantyl fluoroformate, 95%, 1-ADAMANTYL FLUOROFORMATE, 90+%, Adamantan-1-yl carbonofluoridate, 95%,RG. Offered by: Combi-blocks, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 250mg, 5G.
1-adamantyl carbonofluoridate (CAS 62087-82-5) is a chemical compound with the molecular formula C11H15FO2 and a molecular weight of 198.23 g/mol. IUPAC name: 1-adamantyl carbonofluoridate. InChIKey: PNLZKVOKOVFGMZ-UHFFFAOYSA-N.
| Molecular formula | C11H15FO2 |
|---|---|
| Molecular weight | 198.23 g/mol |
| IUPAC name | 1-adamantyl carbonofluoridate |
| InChIKey | PNLZKVOKOVFGMZ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)OC(=O)F |
Computed by PubChem (NCBI)