CAS 850565-40-1 appears in our catalog under these names: 2–(4–fluoro–3–methoxyphenyl)–2–methylpropan–1–ol, 2-(4-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(4-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol (CAS 850565-40-1) is a chemical compound with the molecular formula C11H15FO2 and a molecular weight of 198.23 g/mol. IUPAC name: 2-(4-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol. InChIKey: BZBWCQMFLSDMEB-UHFFFAOYSA-N.
| Molecular formula | C11H15FO2 |
|---|---|
| Molecular weight | 198.23 g/mol |
| IUPAC name | 2-(4-fluoro-3-methoxyphenyl)-2-methylpropan-1-ol |
| InChIKey | BZBWCQMFLSDMEB-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C1=CC(=C(C=C1)F)OC |
Computed by PubChem (NCBI)