Products 1121795-67-2

CAS 1121795-67-2 is the registry number for Carbonothioic acid, S-ethyl O-((5-methyl-2-oxo-1,3-dioxol-4-yl)methyl) ester, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl ethylsulfanylformate (CAS 1121795-67-2) is a chemical compound with the molecular formula C8H10O5S and a molecular weight of 218.23 g/mol. IUPAC name: (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl ethylsulfanylformate. InChIKey: FNMGIGZFOVYSJH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O5S
Molecular weight218.23 g/mol
IUPAC name(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl ethylsulfanylformate
InChIKeyFNMGIGZFOVYSJH-UHFFFAOYSA-N
SMILESCCSC(=O)OCC1=C(OC(=O)O1)C

Computed by PubChem (NCBI)