Products 2167290-66-4
CAS 2167290-66-4 is the registry number for 3,8,8-Trioxo-8λâ¶-thiabicyclo(3.2.1)octane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,8,8-trioxo-8lambda6-thiabicyclo[3.2.1]octane-1-carboxylic acid (CAS 2167290-66-4) is a chemical compound with the molecular formula C8H10O5S and a molecular weight of 218.23 g/mol. IUPAC name: 3,8,8-trioxo-8lambda6-thiabicyclo[3.2.1]octane-1-carboxylic acid. InChIKey: KPDZLDNFTFORSE-UHFFFAOYSA-N.
| Molecular formula | C8H10O5S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | 3,8,8-trioxo-8lambda6-thiabicyclo[3.2.1]octane-1-carboxylic acid |
| InChIKey | KPDZLDNFTFORSE-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(=O)CC1S2(=O)=O)C(=O)O |
Computed by PubChem (NCBI)