CAS 2429952-19-0 is the registry number for Calcium Dobesilate Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,5-dihydroxybenzenesulfonate (CAS 2429952-19-0) is a chemical compound with the molecular formula C8H10O5S and a molecular weight of 218.23 g/mol. IUPAC name: ethyl 2,5-dihydroxybenzenesulfonate. InChIKey: POPRUWSTKFYZAI-UHFFFAOYSA-N.
| Molecular formula | C8H10O5S |
|---|---|
| Molecular weight | 218.23 g/mol |
| IUPAC name | ethyl 2,5-dihydroxybenzenesulfonate |
| InChIKey | POPRUWSTKFYZAI-UHFFFAOYSA-N |
| SMILES | CCOS(=O)(=O)C1=C(C=CC(=C1)O)O |
Computed by PubChem (NCBI)