Products 2429952-19-0

CAS 2429952-19-0 is the registry number for Calcium Dobesilate Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,5-dihydroxybenzenesulfonate (CAS 2429952-19-0) is a chemical compound with the molecular formula C8H10O5S and a molecular weight of 218.23 g/mol. IUPAC name: ethyl 2,5-dihydroxybenzenesulfonate. InChIKey: POPRUWSTKFYZAI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O5S
Molecular weight218.23 g/mol
IUPAC nameethyl 2,5-dihydroxybenzenesulfonate
InChIKeyPOPRUWSTKFYZAI-UHFFFAOYSA-N
SMILESCCOS(=O)(=O)C1=C(C=CC(=C1)O)O

Computed by PubChem (NCBI)