Products 112245-59-7
CAS 112245-59-7 is the registry number for Methyl-3,5-O-isopropylidine-D-xylofuranose. Offered by: Biosynth. Available pack sizes: 20g, 10g.
(4aR,7R,7aR)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol (CAS 112245-59-7) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: (4aR,7R,7aR)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol. InChIKey: DJPWFPRHHGISOM-HBFKVTOISA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (4aR,7R,7aR)-6-methoxy-2,2-dimethyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |
| InChIKey | DJPWFPRHHGISOM-HBFKVTOISA-N |
| SMILES | CC1(OC[C@@H]2[C@H](O1)[C@H](C(O2)OC)O)C |
Computed by PubChem (NCBI)