CAS 112281-28-4 is the registry number for 5-(2-Oxiranyl)-8-(phenylmethoxy)-2(1H)-quinolinone. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 2mg.
5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one (CAS 112281-28-4) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one. InChIKey: IHJYYLJZVBVLEK-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one |
| InChIKey | IHJYYLJZVBVLEK-UHFFFAOYSA-N |
| SMILES | C1C(O1)C2=C3C=CC(=O)NC3=C(C=C2)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)