CAS 112290-07-0 is the registry number for 2,4,5-Trifluorobenzotrifluoride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,2,4-trifluoro-5-(trifluoromethyl)benzene (CAS 112290-07-0) is a chemical compound with the molecular formula C7H2F6 and a molecular weight of 200.08 g/mol. IUPAC name: 1,2,4-trifluoro-5-(trifluoromethyl)benzene. InChIKey: NNHFUVFJLYJMFV-UHFFFAOYSA-N.
| Molecular formula | C7H2F6 |
|---|---|
| Molecular weight | 200.08 g/mol |
| IUPAC name | 1,2,4-trifluoro-5-(trifluoromethyl)benzene |
| InChIKey | NNHFUVFJLYJMFV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)