CAS 122030-02-8 is the registry number for 2,3,6-Trifluorobenzotrifluoride, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
1,2,4-trifluoro-3-(trifluoromethyl)benzene (CAS 122030-02-8) is a chemical compound with the molecular formula C7H2F6 and a molecular weight of 200.08 g/mol. IUPAC name: 1,2,4-trifluoro-3-(trifluoromethyl)benzene. InChIKey: BGHUARSWVAZFNQ-UHFFFAOYSA-N.
| Molecular formula | C7H2F6 |
|---|---|
| Molecular weight | 200.08 g/mol |
| IUPAC name | 1,2,4-trifluoro-3-(trifluoromethyl)benzene |
| InChIKey | BGHUARSWVAZFNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(F)(F)F)F)F |
Computed by PubChem (NCBI)