Products 392-91-6
CAS 392-91-6 is the registry number for 2,3,5-Trifluorobenzotrifluoride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,5-trifluoro-3-(trifluoromethyl)benzene (CAS 392-91-6) is a chemical compound with the molecular formula C7H2F6 and a molecular weight of 200.08 g/mol. IUPAC name: 1,2,5-trifluoro-3-(trifluoromethyl)benzene. InChIKey: YFAHGRXUHXCMCT-UHFFFAOYSA-N.
| Molecular formula | C7H2F6 |
|---|---|
| Molecular weight | 200.08 g/mol |
| IUPAC name | 1,2,5-trifluoro-3-(trifluoromethyl)benzene |
| InChIKey | YFAHGRXUHXCMCT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)F)F |
Computed by PubChem (NCBI)