Products 112337-52-7
CAS 112337-52-7 appears in our catalog under these names: Salbutamol EP Impurity B HCl, Salbutamol impurity B hydrochloride, Salbutamol impurity B hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x5mg, 1x1ml.
4-[2-(tert-butylamino)-1-hydroxyethyl]phenol;hydrochloride (CAS 112337-52-7) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: 4-[2-(tert-butylamino)-1-hydroxyethyl]phenol;hydrochloride. InChIKey: QHAIOSXMJLGSIG-UHFFFAOYSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | 4-[2-(tert-butylamino)-1-hydroxyethyl]phenol;hydrochloride |
| InChIKey | QHAIOSXMJLGSIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)