CAS 112348-45-5 is the registry number for 1–(tert–Butyl) 2–methyl (R)–2–allylpyrrolidine–1,2–dicarboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-O-tert-butyl 2-O-methyl (2R)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate (CAS 112348-45-5) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate. InChIKey: VEYTWFFJGOYPRZ-AWEZNQCLSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| InChIKey | VEYTWFFJGOYPRZ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(CC=C)C(=O)OC |
Computed by PubChem (NCBI)