Products 112348-45-5

CAS 112348-45-5 is the registry number for 1–(tert–Butyl) 2–methyl (R)–2–allylpyrrolidine–1,2–dicarboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl (2R)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate (CAS 112348-45-5) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate. InChIKey: VEYTWFFJGOYPRZ-AWEZNQCLSA-N.

Identity
Molecular formulaC14H23NO4
Molecular weight269.34 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl (2R)-2-prop-2-enylpyrrolidine-1,2-dicarboxylate
InChIKeyVEYTWFFJGOYPRZ-AWEZNQCLSA-N
SMILESCC(C)(C)OC(=O)N1CCC[C@@]1(CC=C)C(=O)OC

Computed by PubChem (NCBI)